C19H28N2O4 — CID 129230404
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-(2-nitroanilino)propanoate (PubChem CID 129230404) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-(2-nitroanilino)propanoate.
| Compound Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-(2-nitroanilino)propanoate |
|---|---|
| PubChem CID | 129230404 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] (2R)-2-(2-nitroanilino)propanoate |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(=O)[C@@H](C)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H28N2O4/c1-12(2)15-10-9-13(3)11-18(15)25-19(22)14(4)20-16-7-5-6-8-17(16)21(23)24/h5-8,12-15,18,20H,9-11H2,1-4H3/t13-,14+,15+,18-/m0/s1 |
| InChIKey | OFQFAMSPCZEBJQ-BORJPKMPSA-N |
| XLogP | 4.40 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|