C17H31NO2 — CID 54670369
[(2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-cyclohexylcarbamate (PubChem CID 54670369) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is [(2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-cyclohexylcarbamate.
| Compound Name | [(2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 54670369 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | [(2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] N-cyclohexylcarbamate |
| SMILES | CC(C)[C@H]1CC[C@H](C)CC1OC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H31NO2/c1-12(2)15-10-9-13(3)11-16(15)20-17(19)18-14-7-5-4-6-8-14/h12-16H,4-11H2,1-3H3,(H,18,19)/t13-,15+,16?/m0/s1 |
| InChIKey | PDDIETGPTXAEPC-GVJPCGBOSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |