C31H49N3O6 — CID 143322108
cyclopentyl 2-[[4-[[8-(cycloheptylmethoxyamino)-8-oxooctanoyl]amino]phenyl]methyl-methoxyamino]acetate (PubChem CID 143322108) has the molecular formula C31H49N3O6 and a molecular weight of 559.75 g/mol. Its IUPAC name is cyclopentyl 2-[[4-[[8-(cycloheptylmethoxyamino)-8-oxooctanoyl]amino]phenyl]methyl-methoxyamino]acetate.
| Compound Name | cyclopentyl 2-[[4-[[8-(cycloheptylmethoxyamino)-8-oxooctanoyl]amino]phenyl]methyl-methoxyamino]acetate |
|---|---|
| PubChem CID | 143322108 |
| Molecular Formula | C31H49N3O6 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.36 |
| IUPAC Name | cyclopentyl 2-[[4-[[8-(cycloheptylmethoxyamino)-8-oxooctanoyl]amino]phenyl]methyl-methoxyamino]acetate |
| SMILES | CON(CC(=O)OC1CCCC1)Cc1ccc(NC(=O)CCCCCCC(=O)NOCC2CCCCCC2)cc1 |
| InChI | InChI=1S/C31H49N3O6/c1-38-34(23-31(37)40-28-14-10-11-15-28)22-25-18-20-27(21-19-25)32-29(35)16-8-4-5-9-17-30(36)33-39-24-26-12-6-2-3-7-13-26/h18-21,26,28H,2-17,22-24H2,1H3,(H,32,35)(H,33,36) |
| InChIKey | RVQCVGGNAIKCFA-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|