C27H27N3O4S — CID 88946176
methyl (2S)-2-[[4-[[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]methyl]phenyl]methylamino]-2-phenylacetate (PubChem CID 88946176) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]methyl]phenyl]methylamino]-2-phenylacetate.
| Compound Name | methyl (2S)-2-[[4-[[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]methyl]phenyl]methylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 88946176 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | methyl (2S)-2-[[4-[[[2-(hydroxycarbamoyl)-1-benzothiophen-6-yl]methylamino]methyl]phenyl]methylamino]-2-phenylacetate |
| SMILES | COC(=O)[C@@H](NCc1ccc(CNCc2ccc3cc(C(=O)NO)sc3c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H27N3O4S/c1-34-27(32)25(21-5-3-2-4-6-21)29-17-19-9-7-18(8-10-19)15-28-16-20-11-12-22-14-24(26(31)30-33)35-23(22)13-20/h2-14,25,28-29,33H,15-17H2,1H3,(H,30,31)/t25-/m0/s1 |
| InChIKey | MKNBADWAXMVSOW-VWLOTQADSA-N |
| XLogP | 4.31 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|