C21H24N2O3S — CID 15604833
N-hydroxy-6-[1-[(4-methoxyphenyl)methylamino]butyl]-1-benzothiophene-2-carboxamide (PubChem CID 15604833) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-hydroxy-6-[1-[(4-methoxyphenyl)methylamino]butyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-hydroxy-6-[1-[(4-methoxyphenyl)methylamino]butyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 15604833 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-hydroxy-6-[1-[(4-methoxyphenyl)methylamino]butyl]-1-benzothiophene-2-carboxamide |
| SMILES | CCCC(NCc1ccc(OC)cc1)c1ccc2cc(C(=O)NO)sc2c1 |
| InChI | InChI=1S/C21H24N2O3S/c1-3-4-18(22-13-14-5-9-17(26-2)10-6-14)15-7-8-16-12-20(21(24)23-25)27-19(16)11-15/h5-12,18,22,25H,3-4,13H2,1-2H3,(H,23,24) |
| InChIKey | RCIGUXMFRSDWIJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|