C25H24FN3O2S — CID 68799194
N-(2-amino-5-fluorophenyl)-6-[2-[(4-methoxyphenyl)methylamino]ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 68799194) has the molecular formula C25H24FN3O2S and a molecular weight of 449.55 g/mol. Its IUPAC name is N-(2-amino-5-fluorophenyl)-6-[2-[(4-methoxyphenyl)methylamino]ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-amino-5-fluorophenyl)-6-[2-[(4-methoxyphenyl)methylamino]ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 68799194 |
| Molecular Formula | C25H24FN3O2S |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-(2-amino-5-fluorophenyl)-6-[2-[(4-methoxyphenyl)methylamino]ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(CNCCc2ccc3cc(C(=O)Nc4cc(F)ccc4N)sc3c2)cc1 |
| InChI | InChI=1S/C25H24FN3O2S/c1-31-20-7-3-17(4-8-20)15-28-11-10-16-2-5-18-13-24(32-23(18)12-16)25(30)29-22-14-19(26)6-9-21(22)27/h2-9,12-14,28H,10-11,15,27H2,1H3,(H,29,30) |
| InChIKey | FPUNQMYOOYCTOF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|