C24H21N3O3S — CID 68697079
N-(2-aminophenyl)-5-[[2-(4-methoxyphenyl)acetyl]amino]-1-benzothiophene-2-carboxamide (PubChem CID 68697079) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[2-(4-methoxyphenyl)acetyl]amino]-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[2-(4-methoxyphenyl)acetyl]amino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 68697079 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-(2-aminophenyl)-5-[[2-(4-methoxyphenyl)acetyl]amino]-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc3sc(C(=O)Nc4ccccc4N)cc3c2)cc1 |
| InChI | InChI=1S/C24H21N3O3S/c1-30-18-9-6-15(7-10-18)12-23(28)26-17-8-11-21-16(13-17)14-22(31-21)24(29)27-20-5-3-2-4-19(20)25/h2-11,13-14H,12,25H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | BOOPNMOIWWJGHS-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|