C17H15NO3S — CID 27844583
N-(2,5-dimethoxyphenyl)-1-benzothiophene-2-carboxamide (PubChem CID 27844583) has the molecular formula C17H15NO3S and a molecular weight of 313.38 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 27844583 |
| Molecular Formula | C17H15NO3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cc3ccccc3s2)c1 |
| InChI | InChI=1S/C17H15NO3S/c1-20-12-7-8-14(21-2)13(10-12)18-17(19)16-9-11-5-3-4-6-15(11)22-16/h3-10H,1-2H3,(H,18,19) |
| InChIKey | OGRQZHYVUXRCMX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |