C20H16N2O4S — CID 20855954
N-(2,5-dimethoxyphenyl)-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxamide (PubChem CID 20855954) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 20855954 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-4-oxo-5H-thieno[3,2-c]quinoline-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2cc3c(=O)[nH]c4ccccc4c3s2)c1 |
| InChI | InChI=1S/C20H16N2O4S/c1-25-11-7-8-16(26-2)15(9-11)22-20(24)17-10-13-18(27-17)12-5-3-4-6-14(12)21-19(13)23/h3-10H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | WCRCGIVDYGIHSH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |