C24H23N3O3 — CID 53114266
1-(2,5-dimethoxyphenyl)-3-[2-(4-methylphenyl)-1H-indol-3-yl]urea (PubChem CID 53114266) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[2-(4-methylphenyl)-1H-indol-3-yl]urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[2-(4-methylphenyl)-1H-indol-3-yl]urea |
|---|---|
| PubChem CID | 53114266 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[2-(4-methylphenyl)-1H-indol-3-yl]urea |
| SMILES | COc1ccc(OC)c(NC(=O)Nc2c(-c3ccc(C)cc3)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C24H23N3O3/c1-15-8-10-16(11-9-15)22-23(18-6-4-5-7-19(18)25-22)27-24(28)26-20-14-17(29-2)12-13-21(20)30-3/h4-14,25H,1-3H3,(H2,26,27,28) |
| InChIKey | KIGAJGFGVFUSOP-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |