C22H20N4O3 — CID 46386711
1-(2,5-dimethoxyphenyl)-3-(2-pyridin-3-yl-1H-indol-3-yl)urea (PubChem CID 46386711) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(2-pyridin-3-yl-1H-indol-3-yl)urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(2-pyridin-3-yl-1H-indol-3-yl)urea |
|---|---|
| PubChem CID | 46386711 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(2-pyridin-3-yl-1H-indol-3-yl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)Nc2c(-c3cccnc3)[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C22H20N4O3/c1-28-15-9-10-19(29-2)18(12-15)25-22(27)26-21-16-7-3-4-8-17(16)24-20(21)14-6-5-11-23-13-14/h3-13,24H,1-2H3,(H2,25,26,27) |
| InChIKey | GAQSFIWCWFGBGN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |