About 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea
1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea (PubChem CID 46386755) has the molecular formula C22H19ClN4O3
and a molecular weight of 422.87 g/mol. Its IUPAC name is 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea.
Molecular Properties
| Compound Name | 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea |
| PubChem CID | 46386755 |
| Molecular Formula | C22H19ClN4O3 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)Nc2c(-c3cccnc3)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C22H19ClN4O3/c1-29-15-6-8-19(30-2)18(11-15)26-22(28)27-21-16-10-14(23)5-7-17(16)25-20(21)13-4-3-9-24-12-13/h3-12,25H,1-2H3,(H2,26,27,28) |
| InChIKey | YOCYHJWYZIBHPC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea?
The IUPAC name of 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea (CID 46386755) is 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea.
What is the SMILES notation for 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea?
The canonical SMILES for 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea is COc1ccc(OC)c(NC(=O)Nc2c(-c3cccnc3)[nH]c3ccc(Cl)cc23)c1.
What is the InChIKey of 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea?
The InChIKey is YOCYHJWYZIBHPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19ClN4O3/c1-29-15-6-8-19(30-2)18(11-15)26-22(28)27-21-16-10-14(23)5-7-17(16)25-20(21)13-4-3-9-24-12-13/h3-12,25H,1-2H3,(H2,26,27,28).
What are the key properties of 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea?
1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea has a molecular weight of 422.87 g/mol, XLogP of 5.54, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea is sourced from PubChem (CID 46386755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).