C22H19ClN4O3 — CID 46386755
1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea (PubChem CID 46386755) has the molecular formula C22H19ClN4O3 and a molecular weight of 422.87 g/mol. Its IUPAC name is 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea.
| Compound Name | 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 46386755 |
| Molecular Formula | C22H19ClN4O3 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-(5-chloro-2-pyridin-3-yl-1H-indol-3-yl)-3-(2,5-dimethoxyphenyl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)Nc2c(-c3cccnc3)[nH]c3ccc(Cl)cc23)c1 |
| InChI | InChI=1S/C22H19ClN4O3/c1-29-15-6-8-19(30-2)18(11-15)26-22(28)27-21-16-10-14(23)5-7-17(16)25-20(21)13-4-3-9-24-12-13/h3-12,25H,1-2H3,(H2,26,27,28) |
| InChIKey | YOCYHJWYZIBHPC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |