C24H20ClN3O3 — CID 10071543
1-(6-chloro-4-phenylquinolin-3-yl)-3-(2,4-dimethoxyphenyl)urea (PubChem CID 10071543) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is 1-(6-chloro-4-phenylquinolin-3-yl)-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-(6-chloro-4-phenylquinolin-3-yl)-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 10071543 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 1-(6-chloro-4-phenylquinolin-3-yl)-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2cnc3ccc(Cl)cc3c2-c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C24H20ClN3O3/c1-30-17-9-11-20(22(13-17)31-2)27-24(29)28-21-14-26-19-10-8-16(25)12-18(19)23(21)15-6-4-3-5-7-15/h3-14H,1-2H3,(H2,27,28,29) |
| InChIKey | JEORDHKEIDTYHR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |