C30H31ClN2O2 — CID 22403898
3,5-ditert-butyl-N-(6-chloro-4-phenylquinolin-3-yl)-4-hydroxybenzamide (PubChem CID 22403898) has the molecular formula C30H31ClN2O2 and a molecular weight of 487.04 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-(6-chloro-4-phenylquinolin-3-yl)-4-hydroxybenzamide.
| Compound Name | 3,5-ditert-butyl-N-(6-chloro-4-phenylquinolin-3-yl)-4-hydroxybenzamide |
|---|---|
| PubChem CID | 22403898 |
| Molecular Formula | C30H31ClN2O2 |
| Molecular Weight | 487.04 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 3,5-ditert-butyl-N-(6-chloro-4-phenylquinolin-3-yl)-4-hydroxybenzamide |
| SMILES | CC(C)(C)c1cc(C(=O)Nc2cnc3ccc(Cl)cc3c2-c2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C30H31ClN2O2/c1-29(2,3)22-14-19(15-23(27(22)34)30(4,5)6)28(35)33-25-17-32-24-13-12-20(31)16-21(24)26(25)18-10-8-7-9-11-18/h7-17,34H,1-6H3,(H,33,35) |
| InChIKey | FTJKINUPIFKHCC-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.04 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |