C20H14F2N4O — CID 46386740
1-(2,4-difluorophenyl)-3-(2-pyridin-3-yl-1H-indol-3-yl)urea (PubChem CID 46386740) has the molecular formula C20H14F2N4O and a molecular weight of 364.36 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-(2-pyridin-3-yl-1H-indol-3-yl)urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-(2-pyridin-3-yl-1H-indol-3-yl)urea |
|---|---|
| PubChem CID | 46386740 |
| Molecular Formula | C20H14F2N4O |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-(2-pyridin-3-yl-1H-indol-3-yl)urea |
| SMILES | O=C(Nc1ccc(F)cc1F)Nc1c(-c2cccnc2)[nH]c2ccccc12 |
| InChI | InChI=1S/C20H14F2N4O/c21-13-7-8-17(15(22)10-13)25-20(27)26-19-14-5-1-2-6-16(14)24-18(19)12-4-3-9-23-11-12/h1-11,24H,(H2,25,26,27) |
| InChIKey | PTXUMUUIIXTSFW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |