C18H16N2O6 — CID 54723744
1-(2,5-dimethoxyphenyl)-3-(4-hydroxy-2-oxochromen-3-yl)urea (PubChem CID 54723744) has the molecular formula C18H16N2O6 and a molecular weight of 356.33 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(4-hydroxy-2-oxochromen-3-yl)urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(4-hydroxy-2-oxochromen-3-yl)urea |
|---|---|
| PubChem CID | 54723744 |
| Molecular Formula | C18H16N2O6 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(4-hydroxy-2-oxochromen-3-yl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)Nc2c(O)c3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C18H16N2O6/c1-24-10-7-8-14(25-2)12(9-10)19-18(23)20-15-16(21)11-5-3-4-6-13(11)26-17(15)22/h3-9,21H,1-2H3,(H2,19,20,23) |
| InChIKey | PJUANBCJAXMAFS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|