C17H17N3O4 — CID 20901323
1-(1,2-benzoxazol-3-ylmethyl)-3-(2,5-dimethoxyphenyl)urea (PubChem CID 20901323) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-(1,2-benzoxazol-3-ylmethyl)-3-(2,5-dimethoxyphenyl)urea.
| Compound Name | 1-(1,2-benzoxazol-3-ylmethyl)-3-(2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 20901323 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-(1,2-benzoxazol-3-ylmethyl)-3-(2,5-dimethoxyphenyl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)NCc2noc3ccccc23)c1 |
| InChI | InChI=1S/C17H17N3O4/c1-22-11-7-8-16(23-2)13(9-11)19-17(21)18-10-14-12-5-3-4-6-15(12)24-20-14/h3-9H,10H2,1-2H3,(H2,18,19,21) |
| InChIKey | WMZUCGJLLQOYJF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |