C20H22N2O4 — CID 46441550
2-(1,2-benzoxazol-3-yl)-N-(2-butoxy-5-methoxyphenyl)acetamide (PubChem CID 46441550) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-(2-butoxy-5-methoxyphenyl)acetamide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-(2-butoxy-5-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 46441550 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-(2-butoxy-5-methoxyphenyl)acetamide |
| SMILES | CCCCOc1ccc(OC)cc1NC(=O)Cc1noc2ccccc12 |
| InChI | InChI=1S/C20H22N2O4/c1-3-4-11-25-19-10-9-14(24-2)12-17(19)21-20(23)13-16-15-7-5-6-8-18(15)26-22-16/h5-10,12H,3-4,11,13H2,1-2H3,(H,21,23) |
| InChIKey | ZFWWCOAXZCMQJH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|