C19H20N2O4 — CID 35540282
2-(1,2-benzoxazol-3-yl)-N-(2,5-diethoxyphenyl)acetamide (PubChem CID 35540282) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-yl)-N-(2,5-diethoxyphenyl)acetamide.
| Compound Name | 2-(1,2-benzoxazol-3-yl)-N-(2,5-diethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 35540282 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-(1,2-benzoxazol-3-yl)-N-(2,5-diethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(OCC)c(NC(=O)Cc2noc3ccccc23)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-3-23-13-9-10-18(24-4-2)16(11-13)20-19(22)12-15-14-7-5-6-8-17(14)25-21-15/h5-11H,3-4,12H2,1-2H3,(H,20,22) |
| InChIKey | YCWTYGOTPGTJSC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |