C23H25N3O4 — CID 35396859
1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-(2-methoxyphenyl)urea (PubChem CID 35396859) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 35396859 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1c(NC2CCCCC2)c2ccccc2oc1=O |
| InChI | InChI=1S/C23H25N3O4/c1-29-19-14-8-6-12-17(19)25-23(28)26-21-20(24-15-9-3-2-4-10-15)16-11-5-7-13-18(16)30-22(21)27/h5-8,11-15,24H,2-4,9-10H2,1H3,(H2,25,26,28) |
| InChIKey | FDNYNDGMNHGJLI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|