C23H25N3O5 — CID 35397241
1-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-(3,4-dimethoxyphenyl)urea (PubChem CID 35397241) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-(3,4-dimethoxyphenyl)urea.
| Compound Name | 1-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-(3,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 35397241 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-(3,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2c(NC3CCCC3)c3ccccc3oc2=O)cc1OC |
| InChI | InChI=1S/C23H25N3O5/c1-29-18-12-11-15(13-19(18)30-2)25-23(28)26-21-20(24-14-7-3-4-8-14)16-9-5-6-10-17(16)31-22(21)27/h5-6,9-14,24H,3-4,7-8H2,1-2H3,(H2,25,26,28) |
| InChIKey | ZAFQANSDJBNGCX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|