C25H22N2O5 — CID 17252009
N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4-dimethoxybenzamide (PubChem CID 17252009) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 17252009 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(NCc3ccccc3)c3ccccc3oc2=O)cc1OC |
| InChI | InChI=1S/C25H22N2O5/c1-30-20-13-12-17(14-21(20)31-2)24(28)27-23-22(26-15-16-8-4-3-5-9-16)18-10-6-7-11-19(18)32-25(23)29/h3-14,26H,15H2,1-2H3,(H,27,28) |
| InChIKey | SXWQGVPVCHLPBI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|