C24H22N2O6S — CID 50778708
N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 50778708) has the molecular formula C24H22N2O6S and a molecular weight of 466.52 g/mol. Its IUPAC name is N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 50778708 |
| Molecular Formula | C24H22N2O6S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2c(NCc3ccccc3)c3ccccc3oc2=O)cc1OC |
| InChI | InChI=1S/C24H22N2O6S/c1-30-20-13-12-17(14-21(20)31-2)33(28,29)26-23-22(25-15-16-8-4-3-5-9-16)18-10-6-7-11-19(18)32-24(23)27/h3-14,25-26H,15H2,1-2H3 |
| InChIKey | LPWYNZHHIWPNAI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|