C26H24N2O6 — CID 17252005
N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4,5-trimethoxybenzamide (PubChem CID 17252005) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 17252005 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | N-[4-(benzylamino)-2-oxochromen-3-yl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2c(NCc3ccccc3)c3ccccc3oc2=O)cc(OC)c1OC |
| InChI | InChI=1S/C26H24N2O6/c1-31-20-13-17(14-21(32-2)24(20)33-3)25(29)28-23-22(27-15-16-9-5-4-6-10-16)18-11-7-8-12-19(18)34-26(23)30/h4-14,27H,15H2,1-3H3,(H,28,29) |
| InChIKey | XULZXVCOSREQLV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|