C25H23N3O4 — CID 50763402
1-[4-(benzylamino)-2-oxochromen-3-yl]-3-(4-ethoxyphenyl)urea (PubChem CID 50763402) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 1-[4-(benzylamino)-2-oxochromen-3-yl]-3-(4-ethoxyphenyl)urea.
| Compound Name | 1-[4-(benzylamino)-2-oxochromen-3-yl]-3-(4-ethoxyphenyl)urea |
|---|---|
| PubChem CID | 50763402 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 1-[4-(benzylamino)-2-oxochromen-3-yl]-3-(4-ethoxyphenyl)urea |
| SMILES | CCOc1ccc(NC(=O)Nc2c(NCc3ccccc3)c3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C25H23N3O4/c1-2-31-19-14-12-18(13-15-19)27-25(30)28-23-22(26-16-17-8-4-3-5-9-17)20-10-6-7-11-21(20)32-24(23)29/h3-15,26H,2,16H2,1H3,(H2,27,28,30) |
| InChIKey | RRXMKNKHXKVSHM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|