C20H21N3O3 — CID 50762131
1-(3-methylphenyl)-3-[2-oxo-4-(propylamino)chromen-3-yl]urea (PubChem CID 50762131) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[2-oxo-4-(propylamino)chromen-3-yl]urea.
| Compound Name | 1-(3-methylphenyl)-3-[2-oxo-4-(propylamino)chromen-3-yl]urea |
|---|---|
| PubChem CID | 50762131 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-(3-methylphenyl)-3-[2-oxo-4-(propylamino)chromen-3-yl]urea |
| SMILES | CCCNc1c(NC(=O)Nc2cccc(C)c2)c(=O)oc2ccccc12 |
| InChI | InChI=1S/C20H21N3O3/c1-3-11-21-17-15-9-4-5-10-16(15)26-19(24)18(17)23-20(25)22-14-8-6-7-13(2)12-14/h4-10,12,21H,3,11H2,1-2H3,(H2,22,23,25) |
| InChIKey | JRHCYBGRYKLFGD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|