C21H23N3O4 — CID 50762086
1-(2-methoxy-5-methylphenyl)-3-[2-oxo-4-(propylamino)chromen-3-yl]urea (PubChem CID 50762086) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-3-[2-oxo-4-(propylamino)chromen-3-yl]urea.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-3-[2-oxo-4-(propylamino)chromen-3-yl]urea |
|---|---|
| PubChem CID | 50762086 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-3-[2-oxo-4-(propylamino)chromen-3-yl]urea |
| SMILES | CCCNc1c(NC(=O)Nc2cc(C)ccc2OC)c(=O)oc2ccccc12 |
| InChI | InChI=1S/C21H23N3O4/c1-4-11-22-18-14-7-5-6-8-16(14)28-20(25)19(18)24-21(26)23-15-12-13(2)9-10-17(15)27-3/h5-10,12,22H,4,11H2,1-3H3,(H2,23,24,26) |
| InChIKey | MLEAVIUNAAMBIR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|