C24H27N3O5 — CID 22433735
1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-(2,5-dimethoxyphenyl)urea (PubChem CID 22433735) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-(2,5-dimethoxyphenyl)urea.
| Compound Name | 1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-(2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 22433735 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-(2,5-dimethoxyphenyl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)Nc2c(NC3CCCCC3)c3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C24H27N3O5/c1-30-16-12-13-20(31-2)18(14-16)26-24(29)27-22-21(25-15-8-4-3-5-9-15)17-10-6-7-11-19(17)32-23(22)28/h6-7,10-15,25H,3-5,8-9H2,1-2H3,(H2,26,27,29) |
| InChIKey | OVCZOXJYLDPPQT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|