C21H20FN3O3 — CID 50763443
1-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-(3-fluorophenyl)urea (PubChem CID 50763443) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is 1-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 50763443 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(Nc1cccc(F)c1)Nc1c(NC2CCCC2)c2ccccc2oc1=O |
| InChI | InChI=1S/C21H20FN3O3/c22-13-6-5-9-15(12-13)24-21(27)25-19-18(23-14-7-1-2-8-14)16-10-3-4-11-17(16)28-20(19)26/h3-6,9-12,14,23H,1-2,7-8H2,(H2,24,25,27) |
| InChIKey | HNPZSMGZXVSKNX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|