C21H27N3O4 — CID 94069805
1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-[[(2S)-oxolan-2-yl]methyl]urea (PubChem CID 94069805) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-[[(2S)-oxolan-2-yl]methyl]urea.
| Compound Name | 1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-[[(2S)-oxolan-2-yl]methyl]urea |
|---|---|
| PubChem CID | 94069805 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 1-[4-(cyclohexylamino)-2-oxochromen-3-yl]-3-[[(2S)-oxolan-2-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CCCO1)Nc1c(NC2CCCCC2)c2ccccc2oc1=O |
| InChI | InChI=1S/C21H27N3O4/c25-20-19(24-21(26)22-13-15-9-6-12-27-15)18(23-14-7-2-1-3-8-14)16-10-4-5-11-17(16)28-20/h4-5,10-11,14-15,23H,1-3,6-9,12-13H2,(H2,22,24,26)/t15-/m0/s1 |
| InChIKey | XKYLMDPMOZLIRH-HNNXBMFYSA-N |
| XLogP | 3.84 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|