C22H21N3O5 — CID 55524189
4-oxo-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]chromene-2-carboxamide (PubChem CID 55524189) has the molecular formula C22H21N3O5 and a molecular weight of 407.43 g/mol. Its IUPAC name is 4-oxo-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]chromene-2-carboxamide.
| Compound Name | 4-oxo-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]chromene-2-carboxamide |
|---|---|
| PubChem CID | 55524189 |
| Molecular Formula | C22H21N3O5 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 4-oxo-N-[4-(oxolan-2-ylmethylcarbamoylamino)phenyl]chromene-2-carboxamide |
| SMILES | O=C(NCC1CCCO1)Nc1ccc(NC(=O)c2cc(=O)c3ccccc3o2)cc1 |
| InChI | InChI=1S/C22H21N3O5/c26-18-12-20(30-19-6-2-1-5-17(18)19)21(27)24-14-7-9-15(10-8-14)25-22(28)23-13-16-4-3-11-29-16/h1-2,5-10,12,16H,3-4,11,13H2,(H,24,27)(H2,23,25,28) |
| InChIKey | BUPJYFAIFCNSQP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |