C17H15NO5 — CID 75769120
4-oxo-N-(oxolan-2-ylmethyl)furo[2,3-b]chromene-2-carboxamide (PubChem CID 75769120) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is 4-oxo-N-(oxolan-2-ylmethyl)furo[2,3-b]chromene-2-carboxamide.
| Compound Name | 4-oxo-N-(oxolan-2-ylmethyl)furo[2,3-b]chromene-2-carboxamide |
|---|---|
| PubChem CID | 75769120 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 4-oxo-N-(oxolan-2-ylmethyl)furo[2,3-b]chromene-2-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1cc2c(=O)c3ccccc3oc2o1 |
| InChI | InChI=1S/C17H15NO5/c19-15-11-5-1-2-6-13(11)22-17-12(15)8-14(23-17)16(20)18-9-10-4-3-7-21-10/h1-2,5-6,8,10H,3-4,7,9H2,(H,18,20) |
| InChIKey | BILXUEYJMQWJQQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |