C13H15N3O2 — CID 4877074
N-(oxolan-2-ylmethyl)-1H-indazole-3-carboxamide (PubChem CID 4877074) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-1H-indazole-3-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 4877074 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-1H-indazole-3-carboxamide |
| SMILES | O=C(NCC1CCCO1)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C13H15N3O2/c17-13(14-8-9-4-3-7-18-9)12-10-5-1-2-6-11(10)15-16-12/h1-2,5-6,9H,3-4,7-8H2,(H,14,17)(H,15,16) |
| InChIKey | WYPQXQSZNWGUDR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |