C17H21N3O2S — CID 97083953
N-[[(2S)-oxolan-2-yl]methyl]-N-[(3S)-thiolan-3-yl]-1H-indazole-3-carboxamide (PubChem CID 97083953) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-N-[(3S)-thiolan-3-yl]-1H-indazole-3-carboxamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-N-[(3S)-thiolan-3-yl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 97083953 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-N-[(3S)-thiolan-3-yl]-1H-indazole-3-carboxamide |
| SMILES | O=C(c1n[nH]c2ccccc12)N(C[C@@H]1CCCO1)[C@H]1CCSC1 |
| InChI | InChI=1S/C17H21N3O2S/c21-17(16-14-5-1-2-6-15(14)18-19-16)20(12-7-9-23-11-12)10-13-4-3-8-22-13/h1-2,5-6,12-13H,3-4,7-11H2,(H,18,19)/t12-,13-/m0/s1 |
| InChIKey | IYZQNPOGJNLXAL-STQMWFEESA-N |
| XLogP | 2.69 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |