C16H20N2O4S — CID 125153508
5-[[(2R)-oxolan-2-yl]methyl-[(3R)-thiolan-3-yl]carbamoyl]pyridine-2-carboxylic acid (PubChem CID 125153508) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 5-[[(2R)-oxolan-2-yl]methyl-[(3R)-thiolan-3-yl]carbamoyl]pyridine-2-carboxylic acid.
| Compound Name | 5-[[(2R)-oxolan-2-yl]methyl-[(3R)-thiolan-3-yl]carbamoyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 125153508 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 5-[[(2R)-oxolan-2-yl]methyl-[(3R)-thiolan-3-yl]carbamoyl]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)N(C[C@H]2CCCO2)[C@@H]2CCSC2)cn1 |
| InChI | InChI=1S/C16H20N2O4S/c19-15(11-3-4-14(16(20)21)17-8-11)18(12-5-7-23-10-12)9-13-2-1-6-22-13/h3-4,8,12-13H,1-2,5-7,9-10H2,(H,20,21)/t12-,13-/m1/s1 |
| InChIKey | UWESUHCHGGHQLO-CHWSQXEVSA-N |
| XLogP | 1.91 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |