C14H18BrNO3S — CID 55613442
5-bromo-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)furan-2-carboxamide (PubChem CID 55613442) has the molecular formula C14H18BrNO3S and a molecular weight of 360.27 g/mol. Its IUPAC name is 5-bromo-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 55613442 |
| Molecular Formula | C14H18BrNO3S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 5-bromo-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)furan-2-carboxamide |
| SMILES | O=C(c1ccc(Br)o1)N(CC1CCCO1)C1CCSC1 |
| InChI | InChI=1S/C14H18BrNO3S/c15-13-4-3-12(19-13)14(17)16(10-5-7-20-9-10)8-11-2-1-6-18-11/h3-4,10-11H,1-2,5-9H2 |
| InChIKey | AOVGOQSQZBQJAR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |