C15H21NO2S2 — CID 97008483
4-methyl-N-[[(2S)-oxolan-2-yl]methyl]-N-[(3S)-thiolan-3-yl]thiophene-3-carboxamide (PubChem CID 97008483) has the molecular formula C15H21NO2S2 and a molecular weight of 311.47 g/mol. Its IUPAC name is 4-methyl-N-[[(2S)-oxolan-2-yl]methyl]-N-[(3S)-thiolan-3-yl]thiophene-3-carboxamide.
| Compound Name | 4-methyl-N-[[(2S)-oxolan-2-yl]methyl]-N-[(3S)-thiolan-3-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 97008483 |
| Molecular Formula | C15H21NO2S2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-methyl-N-[[(2S)-oxolan-2-yl]methyl]-N-[(3S)-thiolan-3-yl]thiophene-3-carboxamide |
| SMILES | Cc1cscc1C(=O)N(C[C@@H]1CCCO1)[C@H]1CCSC1 |
| InChI | InChI=1S/C15H21NO2S2/c1-11-8-20-10-14(11)15(17)16(12-4-6-19-9-12)7-13-3-2-5-18-13/h8,10,12-13H,2-7,9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | MIGMMVUGYACSMA-STQMWFEESA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |