C14H26N2O2S — CID 61163740
(2S)-2-amino-3-methyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)butanamide (PubChem CID 61163740) has the molecular formula C14H26N2O2S and a molecular weight of 286.44 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)butanamide |
|---|---|
| PubChem CID | 61163740 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)butanamide |
| SMILES | CC(C)[C@H](N)C(=O)N(CC1CCCO1)C1CCSC1 |
| InChI | InChI=1S/C14H26N2O2S/c1-10(2)13(15)14(17)16(11-5-7-19-9-11)8-12-4-3-6-18-12/h10-13H,3-9,15H2,1-2H3/t11?,12?,13-/m0/s1 |
| InChIKey | VTJDUSPLVIHCDQ-BPCQOVAHSA-N |
| XLogP | 1.48 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |