C13H24N2O2S — CID 62638054
2-(methylamino)-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)propanamide (PubChem CID 62638054) has the molecular formula C13H24N2O2S and a molecular weight of 272.41 g/mol. Its IUPAC name is 2-(methylamino)-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)propanamide.
| Compound Name | 2-(methylamino)-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 62638054 |
| Molecular Formula | C13H24N2O2S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-(methylamino)-N-(oxolan-2-ylmethyl)-N-(thiolan-3-yl)propanamide |
| SMILES | CNC(C)C(=O)N(CC1CCCO1)C1CCSC1 |
| InChI | InChI=1S/C13H24N2O2S/c1-10(14-2)13(16)15(11-5-7-18-9-11)8-12-4-3-6-17-12/h10-12,14H,3-9H2,1-2H3 |
| InChIKey | OASGKGVPTLMRKS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |