C18H21NO2S — CID 96569970
N-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-N-[(3R)-thiolan-3-yl]prop-2-ynamide (PubChem CID 96569970) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is N-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-N-[(3R)-thiolan-3-yl]prop-2-ynamide.
| Compound Name | N-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-N-[(3R)-thiolan-3-yl]prop-2-ynamide |
|---|---|
| PubChem CID | 96569970 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | N-[[(2R)-oxolan-2-yl]methyl]-3-phenyl-N-[(3R)-thiolan-3-yl]prop-2-ynamide |
| SMILES | O=C(C#Cc1ccccc1)N(C[C@H]1CCCO1)[C@@H]1CCSC1 |
| InChI | InChI=1S/C18H21NO2S/c20-18(9-8-15-5-2-1-3-6-15)19(16-10-12-22-14-16)13-17-7-4-11-21-17/h1-3,5-6,16-17H,4,7,10-14H2/t16-,17-/m1/s1 |
| InChIKey | HOBLPMLIKMICBJ-IAGOWNOFSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|