C17H23N4O2+ — CID 9463048
1H-indazol-3-yl-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]methanone (PubChem CID 9463048) has the molecular formula C17H23N4O2+ and a molecular weight of 315.40 g/mol. Its IUPAC name is 1H-indazol-3-yl-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]methanone.
| Compound Name | 1H-indazol-3-yl-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]methanone |
|---|---|
| PubChem CID | 9463048 |
| Molecular Formula | C17H23N4O2+ |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 1H-indazol-3-yl-[4-[[(2R)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]methanone |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CC[NH+](C[C@H]2CCCO2)CC1 |
| InChI | InChI=1S/C17H22N4O2/c22-17(16-14-5-1-2-6-15(14)18-19-16)21-9-7-20(8-10-21)12-13-4-3-11-23-13/h1-2,5-6,13H,3-4,7-12H2,(H,18,19)/p+1/t13-/m1/s1 |
| InChIKey | QKPBKYMYRDWSCB-CYBMUJFWSA-O |
| XLogP | 0.08 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |