C19H19N3O3 — CID 170858480
1H-indazol-3-yl-[2-(phenoxymethyl)morpholin-4-yl]methanone (PubChem CID 170858480) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1H-indazol-3-yl-[2-(phenoxymethyl)morpholin-4-yl]methanone.
| Compound Name | 1H-indazol-3-yl-[2-(phenoxymethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 170858480 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1H-indazol-3-yl-[2-(phenoxymethyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1n[nH]c2ccccc12)N1CCOC(COc2ccccc2)C1 |
| InChI | InChI=1S/C19H19N3O3/c23-19(18-16-8-4-5-9-17(16)20-21-18)22-10-11-24-15(12-22)13-25-14-6-2-1-3-7-14/h1-9,15H,10-13H2,(H,20,21) |
| InChIKey | ROUDYJCKQYPSDC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |