C17H23N6O2+ — CID 9463055
[4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone (PubChem CID 9463055) has the molecular formula C17H23N6O2+ and a molecular weight of 343.41 g/mol. Its IUPAC name is [4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | [4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 9463055 |
| Molecular Formula | C17H23N6O2+ |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | [4-[[(2S)-oxolan-2-yl]methyl]piperazin-4-ium-1-yl]-[3-(tetrazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-n2cnnn2)c1)N1CC[NH+](C[C@@H]2CCCO2)CC1 |
| InChI | InChI=1S/C17H22N6O2/c24-17(14-3-1-4-15(11-14)23-13-18-19-20-23)22-8-6-21(7-9-22)12-16-5-2-10-25-16/h1,3-4,11,13,16H,2,5-10,12H2/p+1/t16-/m0/s1 |
| InChIKey | XMKRZSOZLKTBJE-INIZCTEOSA-O |
| XLogP | -0.82 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |