C19H19N5OS — CID 90629300
(7-phenyl-1,4-thiazepan-4-yl)-[3-(tetrazol-1-yl)phenyl]methanone (PubChem CID 90629300) has the molecular formula C19H19N5OS and a molecular weight of 365.46 g/mol. Its IUPAC name is (7-phenyl-1,4-thiazepan-4-yl)-[3-(tetrazol-1-yl)phenyl]methanone.
| Compound Name | (7-phenyl-1,4-thiazepan-4-yl)-[3-(tetrazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 90629300 |
| Molecular Formula | C19H19N5OS |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (7-phenyl-1,4-thiazepan-4-yl)-[3-(tetrazol-1-yl)phenyl]methanone |
| SMILES | O=C(c1cccc(-n2cnnn2)c1)N1CCSC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H19N5OS/c25-19(16-7-4-8-17(13-16)24-14-20-21-22-24)23-10-9-18(26-12-11-23)15-5-2-1-3-6-15/h1-8,13-14,18H,9-12H2 |
| InChIKey | DGMDXOWVSVSFDJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |