C21H19NO5S — CID 47026428
N-(4-cyclopentylsulfonylphenyl)-4-oxochromene-2-carboxamide (PubChem CID 47026428) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is N-(4-cyclopentylsulfonylphenyl)-4-oxochromene-2-carboxamide.
| Compound Name | N-(4-cyclopentylsulfonylphenyl)-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 47026428 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | N-(4-cyclopentylsulfonylphenyl)-4-oxochromene-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)C2CCCC2)cc1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C21H19NO5S/c23-18-13-20(27-19-8-4-3-7-17(18)19)21(24)22-14-9-11-16(12-10-14)28(25,26)15-5-1-2-6-15/h3-4,7-13,15H,1-2,5-6H2,(H,22,24) |
| InChIKey | XZESTDOLAJKNML-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |