C19H18N4O3 — CID 122298602
4-oxo-N-(2-piperidin-1-ylpyrimidin-5-yl)chromene-2-carboxamide (PubChem CID 122298602) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 4-oxo-N-(2-piperidin-1-ylpyrimidin-5-yl)chromene-2-carboxamide.
| Compound Name | 4-oxo-N-(2-piperidin-1-ylpyrimidin-5-yl)chromene-2-carboxamide |
|---|---|
| PubChem CID | 122298602 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 4-oxo-N-(2-piperidin-1-ylpyrimidin-5-yl)chromene-2-carboxamide |
| SMILES | O=C(Nc1cnc(N2CCCCC2)nc1)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C19H18N4O3/c24-15-10-17(26-16-7-3-2-6-14(15)16)18(25)22-13-11-20-19(21-12-13)23-8-4-1-5-9-23/h2-3,6-7,10-12H,1,4-5,8-9H2,(H,22,25) |
| InChIKey | VTTOIUVDNXMZAA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |