C24H25N3O4 — CID 35396881
1-(3-acetylphenyl)-3-[4-(cyclohexylamino)-2-oxochromen-3-yl]urea (PubChem CID 35396881) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[4-(cyclohexylamino)-2-oxochromen-3-yl]urea.
| Compound Name | 1-(3-acetylphenyl)-3-[4-(cyclohexylamino)-2-oxochromen-3-yl]urea |
|---|---|
| PubChem CID | 35396881 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[4-(cyclohexylamino)-2-oxochromen-3-yl]urea |
| SMILES | CC(=O)c1cccc(NC(=O)Nc2c(NC3CCCCC3)c3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C24H25N3O4/c1-15(28)16-8-7-11-18(14-16)26-24(30)27-22-21(25-17-9-3-2-4-10-17)19-12-5-6-13-20(19)31-23(22)29/h5-8,11-14,17,25H,2-4,9-10H2,1H3,(H2,26,27,30) |
| InChIKey | GLDFBHWJPHXIJE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|