C22H22ClN3O3 — CID 35397238
1-(2-chloro-4-methylphenyl)-3-[4-(cyclopentylamino)-2-oxochromen-3-yl]urea (PubChem CID 35397238) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is 1-(2-chloro-4-methylphenyl)-3-[4-(cyclopentylamino)-2-oxochromen-3-yl]urea.
| Compound Name | 1-(2-chloro-4-methylphenyl)-3-[4-(cyclopentylamino)-2-oxochromen-3-yl]urea |
|---|---|
| PubChem CID | 35397238 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-(2-chloro-4-methylphenyl)-3-[4-(cyclopentylamino)-2-oxochromen-3-yl]urea |
| SMILES | Cc1ccc(NC(=O)Nc2c(NC3CCCC3)c3ccccc3oc2=O)c(Cl)c1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-13-10-11-17(16(23)12-13)25-22(28)26-20-19(24-14-6-2-3-7-14)15-8-4-5-9-18(15)29-21(20)27/h4-5,8-12,14,24H,2-3,6-7H2,1H3,(H2,25,26,28) |
| InChIKey | AESOZTTZYVOFMR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|