C22H21FN2O3 — CID 50744190
N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-2-(3-fluorophenyl)acetamide (PubChem CID 50744190) has the molecular formula C22H21FN2O3 and a molecular weight of 380.42 g/mol. Its IUPAC name is N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-2-(3-fluorophenyl)acetamide.
| Compound Name | N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-2-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 50744190 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-2-(3-fluorophenyl)acetamide |
| SMILES | O=C(Cc1cccc(F)c1)Nc1c(NC2CCCC2)c2ccccc2oc1=O |
| InChI | InChI=1S/C22H21FN2O3/c23-15-7-5-6-14(12-15)13-19(26)25-21-20(24-16-8-1-2-9-16)17-10-3-4-11-18(17)28-22(21)27/h3-7,10-12,16,24H,1-2,8-9,13H2,(H,25,26) |
| InChIKey | CZWAXNCRDLSKSZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|