C20H18F2N2O4S — CID 50778752
N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3,4-difluorobenzenesulfonamide (PubChem CID 50778752) has the molecular formula C20H18F2N2O4S and a molecular weight of 420.44 g/mol. Its IUPAC name is N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3,4-difluorobenzenesulfonamide.
| Compound Name | N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3,4-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 50778752 |
| Molecular Formula | C20H18F2N2O4S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N-[4-(cyclopentylamino)-2-oxochromen-3-yl]-3,4-difluorobenzenesulfonamide |
| SMILES | O=c1oc2ccccc2c(NC2CCCC2)c1NS(=O)(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H18F2N2O4S/c21-15-10-9-13(11-16(15)22)29(26,27)24-19-18(23-12-5-1-2-6-12)14-7-3-4-8-17(14)28-20(19)25/h3-4,7-12,23-24H,1-2,5-6H2 |
| InChIKey | XAQIOAWTTNZKER-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|